C6H12CuN6S2 — CID 72672069
copper;1-methyl-3-[2-(methylcarbamothioylhydrazinylidene)ethylideneamino]thiourea (PubChem CID 72672069) has the molecular formula C6H12CuN6S2 and a molecular weight of 295.88 g/mol. Its IUPAC name is copper;1-methyl-3-[2-(methylcarbamothioylhydrazinylidene)ethylideneamino]thiourea.
| Compound Name | copper;1-methyl-3-[2-(methylcarbamothioylhydrazinylidene)ethylideneamino]thiourea |
|---|---|
| PubChem CID | 72672069 |
| Molecular Formula | C6H12CuN6S2 |
| Molecular Weight | 295.88 g/mol |
| Exact Mass | 294.99 |
| IUPAC Name | copper;1-methyl-3-[2-(methylcarbamothioylhydrazinylidene)ethylideneamino]thiourea |
| SMILES | CNC(=S)NN=CC=NNC(=S)NC.[Cu] |
| InChI | InChI=1S/C6H12N6S2.Cu/c1-7-5(13)11-9-3-4-10-12-6(14)8-2;/h3-4H,1-2H3,(H2,7,11,13)(H2,8,12,14); |
| InChIKey | MNLAJDKBIQOELG-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 72.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.88 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|