C4H7N3OS — CID 102431292
1-methyl-3-[(Z)-2-oxoethylideneamino]thiourea (PubChem CID 102431292) has the molecular formula C4H7N3OS and a molecular weight of 145.19 g/mol. Its IUPAC name is 1-methyl-3-[(Z)-2-oxoethylideneamino]thiourea.
| Compound Name | 1-methyl-3-[(Z)-2-oxoethylideneamino]thiourea |
|---|---|
| PubChem CID | 102431292 |
| Molecular Formula | C4H7N3OS |
| Molecular Weight | 145.19 g/mol |
| Exact Mass | 145.03 |
| IUPAC Name | 1-methyl-3-[(Z)-2-oxoethylideneamino]thiourea |
| SMILES | CNC(=S)N/N=C\C=O |
| InChI | InChI=1S/C4H7N3OS/c1-5-4(9)7-6-2-3-8/h2-3H,1H3,(H2,5,7,9)/b6-2- |
| InChIKey | LHPRENIWCQJLAV-KXFIGUGUSA-N |
| XLogP | -0.74 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.19 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|