C6H11N3S — CID 3644259
1-(but-2-enylideneamino)-3-methylthiourea (PubChem CID 3644259) has the molecular formula C6H11N3S and a molecular weight of 157.24 g/mol. Its IUPAC name is 1-(but-2-enylideneamino)-3-methylthiourea.
| Compound Name | 1-(but-2-enylideneamino)-3-methylthiourea |
|---|---|
| PubChem CID | 3644259 |
| Molecular Formula | C6H11N3S |
| Molecular Weight | 157.24 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | 1-(but-2-enylideneamino)-3-methylthiourea |
| SMILES | CC=CC=NNC(=S)NC |
| InChI | InChI=1S/C6H11N3S/c1-3-4-5-8-9-6(10)7-2/h3-5H,1-2H3,(H2,7,9,10) |
| InChIKey | AJEYAFTYHQWYST-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.24 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|