C14H22N4O2 — CID 4148126
N,N'-bis(but-2-enylideneamino)hexanediamide (PubChem CID 4148126) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is N,N'-bis(but-2-enylideneamino)hexanediamide.
| Compound Name | N,N'-bis(but-2-enylideneamino)hexanediamide |
|---|---|
| PubChem CID | 4148126 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | N,N'-bis(but-2-enylideneamino)hexanediamide |
| SMILES | CC=CC=NNC(=O)CCCCC(=O)NN=CC=CC |
| InChI | InChI=1S/C14H22N4O2/c1-3-5-11-15-17-13(19)9-7-8-10-14(20)18-16-12-6-4-2/h3-6,11-12H,7-10H2,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | WMKFKJDCQMLEMR-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|