C20H30N2O — CID 3458193
N-(cinnamylideneamino)undecanamide (PubChem CID 3458193) has the molecular formula C20H30N2O and a molecular weight of 314.47 g/mol. Its IUPAC name is N-(cinnamylideneamino)undecanamide.
| Compound Name | N-(cinnamylideneamino)undecanamide |
|---|---|
| PubChem CID | 3458193 |
| Molecular Formula | C20H30N2O |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.24 |
| IUPAC Name | N-(cinnamylideneamino)undecanamide |
| SMILES | CCCCCCCCCCC(=O)NN=CC=Cc1ccccc1 |
| InChI | InChI=1S/C20H30N2O/c1-2-3-4-5-6-7-8-12-17-20(23)22-21-18-13-16-19-14-10-9-11-15-19/h9-11,13-16,18H,2-8,12,17H2,1H3,(H,22,23) |
| InChIKey | PINCGSZZFNCKSM-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|