C24H26N4O2S — CID 92529742
3-[3-oxo-3-[(2E)-2-[(Z)-3-phenylprop-2-enylidene]hydrazinyl]propyl]sulfanyl-N-[(E)-[(Z)-3-phenylprop-2-enylidene]amino]propanamide (PubChem CID 92529742) has the molecular formula C24H26N4O2S and a molecular weight of 434.56 g/mol. Its IUPAC name is 3-[3-oxo-3-[(2E)-2-[(Z)-3-phenylprop-2-enylidene]hydrazinyl]propyl]sulfanyl-N-[(E)-[(Z)-3-phenylprop-2-enylidene]amino]propanamide.
| Compound Name | 3-[3-oxo-3-[(2E)-2-[(Z)-3-phenylprop-2-enylidene]hydrazinyl]propyl]sulfanyl-N-[(E)-[(Z)-3-phenylprop-2-enylidene]amino]propanamide |
|---|---|
| PubChem CID | 92529742 |
| Molecular Formula | C24H26N4O2S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 3-[3-oxo-3-[(2E)-2-[(Z)-3-phenylprop-2-enylidene]hydrazinyl]propyl]sulfanyl-N-[(E)-[(Z)-3-phenylprop-2-enylidene]amino]propanamide |
| SMILES | O=C(CCSCCC(=O)N/N=C/C=C\c1ccccc1)N/N=C/C=C\c1ccccc1 |
| InChI | InChI=1S/C24H26N4O2S/c29-23(27-25-17-7-13-21-9-3-1-4-10-21)15-19-31-20-16-24(30)28-26-18-8-14-22-11-5-2-6-12-22/h1-14,17-18H,15-16,19-20H2,(H,27,29)(H,28,30)/b13-7-,14-8-,25-17+,26-18+ |
| InChIKey | XJIDPSLTNBKHTD-DFIMXBKUSA-N |
| XLogP | 4.13 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|