C22H27N4O+ — CID 7955734
3-(4-phenylpiperazin-1-ium-1-yl)-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]propanamide (PubChem CID 7955734) has the molecular formula C22H27N4O+ and a molecular weight of 363.49 g/mol. Its IUPAC name is 3-(4-phenylpiperazin-1-ium-1-yl)-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]propanamide.
| Compound Name | 3-(4-phenylpiperazin-1-ium-1-yl)-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]propanamide |
|---|---|
| PubChem CID | 7955734 |
| Molecular Formula | C22H27N4O+ |
| Molecular Weight | 363.49 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | 3-(4-phenylpiperazin-1-ium-1-yl)-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]propanamide |
| SMILES | O=C(CC[NH+]1CCN(c2ccccc2)CC1)N/N=C\C=C\c1ccccc1 |
| InChI | InChI=1S/C22H26N4O/c27-22(24-23-14-7-10-20-8-3-1-4-9-20)13-15-25-16-18-26(19-17-25)21-11-5-2-6-12-21/h1-12,14H,13,15-19H2,(H,24,27)/p+1/b10-7+,23-14- |
| InChIKey | ULOARSDKGFTOBY-SXJABBKVSA-O |
| XLogP | 1.60 |
| TPSA | 49.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.49 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|