C22H29N4O2+ — CID 7955819
N-[(Z)-(4-ethoxyphenyl)methylideneamino]-3-(4-phenylpiperazin-1-ium-1-yl)propanamide (PubChem CID 7955819) has the molecular formula C22H29N4O2+ and a molecular weight of 381.50 g/mol. Its IUPAC name is N-[(Z)-(4-ethoxyphenyl)methylideneamino]-3-(4-phenylpiperazin-1-ium-1-yl)propanamide.
| Compound Name | N-[(Z)-(4-ethoxyphenyl)methylideneamino]-3-(4-phenylpiperazin-1-ium-1-yl)propanamide |
|---|---|
| PubChem CID | 7955819 |
| Molecular Formula | C22H29N4O2+ |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | N-[(Z)-(4-ethoxyphenyl)methylideneamino]-3-(4-phenylpiperazin-1-ium-1-yl)propanamide |
| SMILES | CCOc1ccc(/C=N\NC(=O)CC[NH+]2CCN(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C22H28N4O2/c1-2-28-21-10-8-19(9-11-21)18-23-24-22(27)12-13-25-14-16-26(17-15-25)20-6-4-3-5-7-20/h3-11,18H,2,12-17H2,1H3,(H,24,27)/p+1/b23-18- |
| InChIKey | RVPSMWAVZAIOGI-NKFKGCMQSA-O |
| XLogP | 1.33 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|