C21H27N4O2+ — CID 2692852
N-[(3-methoxyphenyl)methylideneamino]-3-(4-phenylpiperazin-1-ium-1-yl)propanamide (PubChem CID 2692852) has the molecular formula C21H27N4O2+ and a molecular weight of 367.47 g/mol. Its IUPAC name is N-[(3-methoxyphenyl)methylideneamino]-3-(4-phenylpiperazin-1-ium-1-yl)propanamide.
| Compound Name | N-[(3-methoxyphenyl)methylideneamino]-3-(4-phenylpiperazin-1-ium-1-yl)propanamide |
|---|---|
| PubChem CID | 2692852 |
| Molecular Formula | C21H27N4O2+ |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | N-[(3-methoxyphenyl)methylideneamino]-3-(4-phenylpiperazin-1-ium-1-yl)propanamide |
| SMILES | COc1cccc(C=NNC(=O)CC[NH+]2CCN(c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C21H26N4O2/c1-27-20-9-5-6-18(16-20)17-22-23-21(26)10-11-24-12-14-25(15-13-24)19-7-3-2-4-8-19/h2-9,16-17H,10-15H2,1H3,(H,23,26)/p+1 |
| InChIKey | IDXMYBGYUFEDSR-UHFFFAOYSA-O |
| XLogP | 0.94 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|