C21H25F2N4O2+ — CID 7529901
N-[(Z)-[2-(difluoromethoxy)phenyl]methylideneamino]-3-(4-phenylpiperazin-1-ium-1-yl)propanamide (PubChem CID 7529901) has the molecular formula C21H25F2N4O2+ and a molecular weight of 403.45 g/mol. Its IUPAC name is N-[(Z)-[2-(difluoromethoxy)phenyl]methylideneamino]-3-(4-phenylpiperazin-1-ium-1-yl)propanamide.
| Compound Name | N-[(Z)-[2-(difluoromethoxy)phenyl]methylideneamino]-3-(4-phenylpiperazin-1-ium-1-yl)propanamide |
|---|---|
| PubChem CID | 7529901 |
| Molecular Formula | C21H25F2N4O2+ |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | N-[(Z)-[2-(difluoromethoxy)phenyl]methylideneamino]-3-(4-phenylpiperazin-1-ium-1-yl)propanamide |
| SMILES | O=C(CC[NH+]1CCN(c2ccccc2)CC1)N/N=C\c1ccccc1OC(F)F |
| InChI | InChI=1S/C21H24F2N4O2/c22-21(23)29-19-9-5-4-6-17(19)16-24-25-20(28)10-11-26-12-14-27(15-13-26)18-7-2-1-3-8-18/h1-9,16,21H,10-15H2,(H,25,28)/p+1/b24-16- |
| InChIKey | VWGZOWRGLFRLIU-JLPGSUDCSA-O |
| XLogP | 1.53 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|