C23H20F2N2O3 — CID 9359679
2-(2-benzylphenoxy)-N-[(Z)-[2-(difluoromethoxy)phenyl]methylideneamino]acetamide (PubChem CID 9359679) has the molecular formula C23H20F2N2O3 and a molecular weight of 410.42 g/mol. Its IUPAC name is 2-(2-benzylphenoxy)-N-[(Z)-[2-(difluoromethoxy)phenyl]methylideneamino]acetamide.
| Compound Name | 2-(2-benzylphenoxy)-N-[(Z)-[2-(difluoromethoxy)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 9359679 |
| Molecular Formula | C23H20F2N2O3 |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 2-(2-benzylphenoxy)-N-[(Z)-[2-(difluoromethoxy)phenyl]methylideneamino]acetamide |
| SMILES | O=C(COc1ccccc1Cc1ccccc1)N/N=C\c1ccccc1OC(F)F |
| InChI | InChI=1S/C23H20F2N2O3/c24-23(25)30-21-13-7-5-11-19(21)15-26-27-22(28)16-29-20-12-6-4-10-18(20)14-17-8-2-1-3-9-17/h1-13,15,23H,14,16H2,(H,27,28)/b26-15- |
| InChIKey | UXERJSFGOATDGG-YSMPRRRNSA-N |
| XLogP | 4.41 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|