C23H20F2N2O4 — CID 2383085
N-[[2-(difluoromethoxy)phenyl]methylideneamino]-2-(2-phenoxyethoxy)benzamide (PubChem CID 2383085) has the molecular formula C23H20F2N2O4 and a molecular weight of 426.42 g/mol. Its IUPAC name is N-[[2-(difluoromethoxy)phenyl]methylideneamino]-2-(2-phenoxyethoxy)benzamide.
| Compound Name | N-[[2-(difluoromethoxy)phenyl]methylideneamino]-2-(2-phenoxyethoxy)benzamide |
|---|---|
| PubChem CID | 2383085 |
| Molecular Formula | C23H20F2N2O4 |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | N-[[2-(difluoromethoxy)phenyl]methylideneamino]-2-(2-phenoxyethoxy)benzamide |
| SMILES | O=C(NN=Cc1ccccc1OC(F)F)c1ccccc1OCCOc1ccccc1 |
| InChI | InChI=1S/C23H20F2N2O4/c24-23(25)31-20-12-6-4-8-17(20)16-26-27-22(28)19-11-5-7-13-21(19)30-15-14-29-18-9-2-1-3-10-18/h1-13,16,23H,14-15H2,(H,27,28) |
| InChIKey | RQIUSVDQQUPZPU-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|