C22H18F2N2O2 — CID 9359716
2-(2-benzylphenoxy)-N-[(Z)-(3,4-difluorophenyl)methylideneamino]acetamide (PubChem CID 9359716) has the molecular formula C22H18F2N2O2 and a molecular weight of 380.39 g/mol. Its IUPAC name is 2-(2-benzylphenoxy)-N-[(Z)-(3,4-difluorophenyl)methylideneamino]acetamide.
| Compound Name | 2-(2-benzylphenoxy)-N-[(Z)-(3,4-difluorophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 9359716 |
| Molecular Formula | C22H18F2N2O2 |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 2-(2-benzylphenoxy)-N-[(Z)-(3,4-difluorophenyl)methylideneamino]acetamide |
| SMILES | O=C(COc1ccccc1Cc1ccccc1)N/N=C\c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C22H18F2N2O2/c23-19-11-10-17(13-20(19)24)14-25-26-22(27)15-28-21-9-5-4-8-18(21)12-16-6-2-1-3-7-16/h1-11,13-14H,12,15H2,(H,26,27)/b25-14- |
| InChIKey | VYIILPUMEZLCCG-QFEZKATASA-N |
| XLogP | 4.08 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|