C20H22ClN5O4 — CID 6910208
4-chloro-2-nitro-6-[(E)-[3-(4-phenylpiperazin-1-ium-1-yl)propanoylhydrazinylidene]methyl]phenolate (PubChem CID 6910208) has the molecular formula C20H22ClN5O4 and a molecular weight of 431.88 g/mol. Its IUPAC name is 4-chloro-2-nitro-6-[(E)-[3-(4-phenylpiperazin-1-ium-1-yl)propanoylhydrazinylidene]methyl]phenolate.
| Compound Name | 4-chloro-2-nitro-6-[(E)-[3-(4-phenylpiperazin-1-ium-1-yl)propanoylhydrazinylidene]methyl]phenolate |
|---|---|
| PubChem CID | 6910208 |
| Molecular Formula | C20H22ClN5O4 |
| Molecular Weight | 431.88 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | 4-chloro-2-nitro-6-[(E)-[3-(4-phenylpiperazin-1-ium-1-yl)propanoylhydrazinylidene]methyl]phenolate |
| SMILES | O=C(CC[NH+]1CCN(c2ccccc2)CC1)N/N=C/c1cc(Cl)cc([N+](=O)[O-])c1[O-] |
| InChI | InChI=1S/C20H22ClN5O4/c21-16-12-15(20(28)18(13-16)26(29)30)14-22-23-19(27)6-7-24-8-10-25(11-9-24)17-4-2-1-3-5-17/h1-5,12-14,28H,6-11H2,(H,23,27)/b22-14+ |
| InChIKey | VRRBOZCOCRJRKX-HYARGMPZSA-N |
| XLogP | 0.57 |
| TPSA | 115.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.88 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|