C22H18ClN4O5- — CID 7101777
4-chloro-2-[[4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]iminomethyl]-6-nitrophenolate (PubChem CID 7101777) has the molecular formula C22H18ClN4O5- and a molecular weight of 453.86 g/mol. Its IUPAC name is 4-chloro-2-[[4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]iminomethyl]-6-nitrophenolate.
| Compound Name | 4-chloro-2-[[4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]iminomethyl]-6-nitrophenolate |
|---|---|
| PubChem CID | 7101777 |
| Molecular Formula | C22H18ClN4O5- |
| Molecular Weight | 453.86 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | 4-chloro-2-[[4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]iminomethyl]-6-nitrophenolate |
| SMILES | O=C(c1ccco1)N1CCN(c2ccc(/N=C/c3cc(Cl)cc([N+](=O)[O-])c3[O-])cc2)CC1 |
| InChI | InChI=1S/C22H19ClN4O5/c23-16-12-15(21(28)19(13-16)27(30)31)14-24-17-3-5-18(6-4-17)25-7-9-26(10-8-25)22(29)20-2-1-11-32-20/h1-6,11-14,28H,7-10H2/p-1/b24-14+ |
| InChIKey | LKGXQLVXJCIFJZ-ZVHZXABRSA-M |
| XLogP | 3.63 |
| TPSA | 115.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.86 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|