C20H21ClN4O4 — CID 3695765
1-[4-[4-[(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]phenyl]piperazin-1-yl]propan-1-one (PubChem CID 3695765) has the molecular formula C20H21ClN4O4 and a molecular weight of 416.87 g/mol. Its IUPAC name is 1-[4-[4-[(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]phenyl]piperazin-1-yl]propan-1-one.
| Compound Name | 1-[4-[4-[(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]phenyl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 3695765 |
| Molecular Formula | C20H21ClN4O4 |
| Molecular Weight | 416.87 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 1-[4-[4-[(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]phenyl]piperazin-1-yl]propan-1-one |
| SMILES | CCC(=O)N1CCN(c2ccc(/N=C/c3cc(Cl)cc([N+](=O)[O-])c3O)cc2)CC1 |
| InChI | InChI=1S/C20H21ClN4O4/c1-2-19(26)24-9-7-23(8-10-24)17-5-3-16(4-6-17)22-13-14-11-15(21)12-18(20(14)27)25(28)29/h3-6,11-13,27H,2,7-10H2,1H3/b22-13+ |
| InChIKey | NVSBZYINVZPAOU-LPYMAVHISA-N |
| XLogP | 3.76 |
| TPSA | 99.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.87 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|