C18H18ClN3O4 — CID 135758045
3-[(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-N,N-diethylbenzamide (PubChem CID 135758045) has the molecular formula C18H18ClN3O4 and a molecular weight of 375.81 g/mol. Its IUPAC name is 3-[(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-N,N-diethylbenzamide.
| Compound Name | 3-[(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 135758045 |
| Molecular Formula | C18H18ClN3O4 |
| Molecular Weight | 375.81 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 3-[(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1cccc(/N=C/c2cc(Cl)cc([N+](=O)[O-])c2O)c1 |
| InChI | InChI=1S/C18H18ClN3O4/c1-3-21(4-2)18(24)12-6-5-7-15(9-12)20-11-13-8-14(19)10-16(17(13)23)22(25)26/h5-11,23H,3-4H2,1-2H3/b20-11+ |
| InChIKey | PRGYRHZLFZFKHZ-RGVLZGJSSA-N |
| XLogP | 4.19 |
| TPSA | 96.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.81 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|