C17H13ClN2O7 — CID 135595460
dimethyl 5-[(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]benzene-1,3-dicarboxylate (PubChem CID 135595460) has the molecular formula C17H13ClN2O7 and a molecular weight of 392.75 g/mol. Its IUPAC name is dimethyl 5-[(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 135595460 |
| Molecular Formula | C17H13ClN2O7 |
| Molecular Weight | 392.75 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | dimethyl 5-[(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(/N=C/c2cc(Cl)cc([N+](=O)[O-])c2O)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C17H13ClN2O7/c1-26-16(22)9-3-10(17(23)27-2)6-13(5-9)19-8-11-4-12(18)7-14(15(11)21)20(24)25/h3-8,21H,1-2H3/b19-8+ |
| InChIKey | XDZWMNZPRSXSTD-UFWORHAWSA-N |
| XLogP | 3.28 |
| TPSA | 128.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.75 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|