C10H10ClN3O5 — CID 4266436
ethyl N-[(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]carbamate (PubChem CID 4266436) has the molecular formula C10H10ClN3O5 and a molecular weight of 287.66 g/mol. Its IUPAC name is ethyl N-[(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]carbamate.
| Compound Name | ethyl N-[(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]carbamate |
|---|---|
| PubChem CID | 4266436 |
| Molecular Formula | C10H10ClN3O5 |
| Molecular Weight | 287.66 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | ethyl N-[(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]carbamate |
| SMILES | CCOC(=O)NN=Cc1cc(Cl)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C10H10ClN3O5/c1-2-19-10(16)13-12-5-6-3-7(11)4-8(9(6)15)14(17)18/h3-5,15H,2H2,1H3,(H,13,16) |
| InChIKey | IMMNOSJEBFRFIK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 114.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.66 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|