C17H15NO5 — CID 135595463
dimethyl 5-[(2-hydroxyphenyl)methylideneamino]benzene-1,3-dicarboxylate (PubChem CID 135595463) has the molecular formula C17H15NO5 and a molecular weight of 313.31 g/mol. Its IUPAC name is dimethyl 5-[(2-hydroxyphenyl)methylideneamino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[(2-hydroxyphenyl)methylideneamino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 135595463 |
| Molecular Formula | C17H15NO5 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | dimethyl 5-[(2-hydroxyphenyl)methylideneamino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(/N=C/c2ccccc2O)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C17H15NO5/c1-22-16(20)12-7-13(17(21)23-2)9-14(8-12)18-10-11-5-3-4-6-15(11)19/h3-10,19H,1-2H3/b18-10+ |
| InChIKey | LOZQXOFTASEBSI-VCHYOVAHSA-N |
| XLogP | 2.72 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|