C15H13NO4 — CID 623233
methyl 4-[(2,4-dihydroxyphenyl)methylideneamino]benzoate (PubChem CID 623233) has the molecular formula C15H13NO4 and a molecular weight of 271.27 g/mol. Its IUPAC name is methyl 4-[(2,4-dihydroxyphenyl)methylideneamino]benzoate.
| Compound Name | methyl 4-[(2,4-dihydroxyphenyl)methylideneamino]benzoate |
|---|---|
| PubChem CID | 623233 |
| Molecular Formula | C15H13NO4 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | methyl 4-[(2,4-dihydroxyphenyl)methylideneamino]benzoate |
| SMILES | COC(=O)c1ccc(/N=C/c2ccc(O)cc2O)cc1 |
| InChI | InChI=1S/C15H13NO4/c1-20-15(19)10-2-5-12(6-3-10)16-9-11-4-7-13(17)8-14(11)18/h2-9,17-18H,1H3/b16-9+ |
| InChIKey | NYHLFRDYZLACTM-CXUHLZMHSA-N |
| XLogP | 2.63 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|