C23H21N3O4 — CID 3578140
ethyl 4-[[2-hydroxy-4-[(4-methoxyphenyl)diazenyl]phenyl]methylideneamino]benzoate (PubChem CID 3578140) has the molecular formula C23H21N3O4 and a molecular weight of 403.44 g/mol. Its IUPAC name is ethyl 4-[[2-hydroxy-4-[(4-methoxyphenyl)diazenyl]phenyl]methylideneamino]benzoate.
| Compound Name | ethyl 4-[[2-hydroxy-4-[(4-methoxyphenyl)diazenyl]phenyl]methylideneamino]benzoate |
|---|---|
| PubChem CID | 3578140 |
| Molecular Formula | C23H21N3O4 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | ethyl 4-[[2-hydroxy-4-[(4-methoxyphenyl)diazenyl]phenyl]methylideneamino]benzoate |
| SMILES | CCOC(=O)c1ccc(/N=C/c2ccc(/N=N/c3ccc(OC)cc3)cc2O)cc1 |
| InChI | InChI=1S/C23H21N3O4/c1-3-30-23(28)16-4-7-18(8-5-16)24-15-17-6-9-20(14-22(17)27)26-25-19-10-12-21(29-2)13-11-19/h4-15,27H,3H2,1-2H3/b24-15+,26-25+ |
| InChIKey | SZACMQIWCVGBKZ-WBHRPZRPSA-N |
| XLogP | 5.74 |
| TPSA | 92.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|