C16H15NO4 — CID 3416784
ethyl 4-[(3,4-dihydroxyphenyl)methylideneamino]benzoate (PubChem CID 3416784) has the molecular formula C16H15NO4 and a molecular weight of 285.30 g/mol. Its IUPAC name is ethyl 4-[(3,4-dihydroxyphenyl)methylideneamino]benzoate.
| Compound Name | ethyl 4-[(3,4-dihydroxyphenyl)methylideneamino]benzoate |
|---|---|
| PubChem CID | 3416784 |
| Molecular Formula | C16H15NO4 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | ethyl 4-[(3,4-dihydroxyphenyl)methylideneamino]benzoate |
| SMILES | CCOC(=O)c1ccc(/N=C/c2ccc(O)c(O)c2)cc1 |
| InChI | InChI=1S/C16H15NO4/c1-2-21-16(20)12-4-6-13(7-5-12)17-10-11-3-8-14(18)15(19)9-11/h3-10,18-19H,2H2,1H3/b17-10+ |
| InChIKey | JYSZQHQKMQKSFI-LICLKQGHSA-N |
| XLogP | 3.03 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|