C18H19NO3 — CID 4257096
ethyl 3-[(4-hydroxy-3,5-dimethylphenyl)methylideneamino]benzoate (PubChem CID 4257096) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is ethyl 3-[(4-hydroxy-3,5-dimethylphenyl)methylideneamino]benzoate.
| Compound Name | ethyl 3-[(4-hydroxy-3,5-dimethylphenyl)methylideneamino]benzoate |
|---|---|
| PubChem CID | 4257096 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | ethyl 3-[(4-hydroxy-3,5-dimethylphenyl)methylideneamino]benzoate |
| SMILES | CCOC(=O)c1cccc(/N=C/c2cc(C)c(O)c(C)c2)c1 |
| InChI | InChI=1S/C18H19NO3/c1-4-22-18(21)15-6-5-7-16(10-15)19-11-14-8-12(2)17(20)13(3)9-14/h5-11,20H,4H2,1-3H3/b19-11+ |
| InChIKey | YLUVQGAOKCMLAR-YBFXNURJSA-N |
| XLogP | 3.94 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|