C19H15ClN2O4 — CID 4654429
ethyl 3-[[2-(4-chlorophenyl)-5-hydroxy-1,3-oxazol-4-yl]methylideneamino]benzoate (PubChem CID 4654429) has the molecular formula C19H15ClN2O4 and a molecular weight of 370.79 g/mol. Its IUPAC name is ethyl 3-[[2-(4-chlorophenyl)-5-hydroxy-1,3-oxazol-4-yl]methylideneamino]benzoate.
| Compound Name | ethyl 3-[[2-(4-chlorophenyl)-5-hydroxy-1,3-oxazol-4-yl]methylideneamino]benzoate |
|---|---|
| PubChem CID | 4654429 |
| Molecular Formula | C19H15ClN2O4 |
| Molecular Weight | 370.79 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | ethyl 3-[[2-(4-chlorophenyl)-5-hydroxy-1,3-oxazol-4-yl]methylideneamino]benzoate |
| SMILES | CCOC(=O)c1cccc(/N=C/c2nc(-c3ccc(Cl)cc3)oc2O)c1 |
| InChI | InChI=1S/C19H15ClN2O4/c1-2-25-18(23)13-4-3-5-15(10-13)21-11-16-19(24)26-17(22-16)12-6-8-14(20)9-7-12/h3-11,24H,2H2,1H3/b21-11+ |
| InChIKey | PVEXOAFMSMFKQY-SRZZPIQSSA-N |
| XLogP | 4.63 |
| TPSA | 84.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.79 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|