C15H11ClN3O2+ — CID 135492005
2-(4-chlorophenyl)-4-(pyridin-1-ium-3-yliminomethyl)-1,3-oxazol-5-ol (PubChem CID 135492005) has the molecular formula C15H11ClN3O2+ and a molecular weight of 300.73 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4-(pyridin-1-ium-3-yliminomethyl)-1,3-oxazol-5-ol.
| Compound Name | 2-(4-chlorophenyl)-4-(pyridin-1-ium-3-yliminomethyl)-1,3-oxazol-5-ol |
|---|---|
| PubChem CID | 135492005 |
| Molecular Formula | C15H11ClN3O2+ |
| Molecular Weight | 300.73 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 2-(4-chlorophenyl)-4-(pyridin-1-ium-3-yliminomethyl)-1,3-oxazol-5-ol |
| SMILES | Oc1oc(-c2ccc(Cl)cc2)nc1/C=N/c1ccc[nH+]c1 |
| InChI | InChI=1S/C15H10ClN3O2/c16-11-5-3-10(4-6-11)14-19-13(15(20)21-14)9-18-12-2-1-7-17-8-12/h1-9,20H/p+1/b18-9+ |
| InChIKey | MEDUUPSMXCDYTP-GIJQJNRQSA-O |
| XLogP | 3.27 |
| TPSA | 72.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.73 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|