C15H10ClN3O2 — CID 3426164
2-(4-chlorophenyl)-4-(pyridin-2-yliminomethyl)-1,3-oxazol-5-ol (PubChem CID 3426164) has the molecular formula C15H10ClN3O2 and a molecular weight of 299.72 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4-(pyridin-2-yliminomethyl)-1,3-oxazol-5-ol.
| Compound Name | 2-(4-chlorophenyl)-4-(pyridin-2-yliminomethyl)-1,3-oxazol-5-ol |
|---|---|
| PubChem CID | 3426164 |
| Molecular Formula | C15H10ClN3O2 |
| Molecular Weight | 299.72 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 2-(4-chlorophenyl)-4-(pyridin-2-yliminomethyl)-1,3-oxazol-5-ol |
| SMILES | Oc1oc(-c2ccc(Cl)cc2)nc1C=Nc1ccccn1 |
| InChI | InChI=1S/C15H10ClN3O2/c16-11-6-4-10(5-7-11)14-19-12(15(20)21-14)9-18-13-3-1-2-8-17-13/h1-9,20H |
| InChIKey | SECKSZYPCRQFGZ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 71.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.72 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|