C16H10BrClN2O2 — CID 5201918
4-[(2-bromophenyl)iminomethyl]-2-(4-chlorophenyl)-1,3-oxazol-5-ol (PubChem CID 5201918) has the molecular formula C16H10BrClN2O2 and a molecular weight of 377.63 g/mol. Its IUPAC name is 4-[(2-bromophenyl)iminomethyl]-2-(4-chlorophenyl)-1,3-oxazol-5-ol.
| Compound Name | 4-[(2-bromophenyl)iminomethyl]-2-(4-chlorophenyl)-1,3-oxazol-5-ol |
|---|---|
| PubChem CID | 5201918 |
| Molecular Formula | C16H10BrClN2O2 |
| Molecular Weight | 377.63 g/mol |
| Exact Mass | 375.96 |
| IUPAC Name | 4-[(2-bromophenyl)iminomethyl]-2-(4-chlorophenyl)-1,3-oxazol-5-ol |
| SMILES | Oc1oc(-c2ccc(Cl)cc2)nc1/C=N/c1ccccc1Br |
| InChI | InChI=1S/C16H10BrClN2O2/c17-12-3-1-2-4-13(12)19-9-14-16(21)22-15(20-14)10-5-7-11(18)8-6-10/h1-9,21H/b19-9+ |
| InChIKey | SMMCCUOWDGSOEM-DJKKODMXSA-N |
| XLogP | 5.21 |
| TPSA | 58.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.63 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|