C17H11Br2ClN2O3 — CID 4021538
2-(5-chloro-2-methoxyphenyl)-4-[(2,4-dibromophenyl)iminomethyl]-1,3-oxazol-5-ol (PubChem CID 4021538) has the molecular formula C17H11Br2ClN2O3 and a molecular weight of 486.55 g/mol. Its IUPAC name is 2-(5-chloro-2-methoxyphenyl)-4-[(2,4-dibromophenyl)iminomethyl]-1,3-oxazol-5-ol.
| Compound Name | 2-(5-chloro-2-methoxyphenyl)-4-[(2,4-dibromophenyl)iminomethyl]-1,3-oxazol-5-ol |
|---|---|
| PubChem CID | 4021538 |
| Molecular Formula | C17H11Br2ClN2O3 |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 483.88 |
| IUPAC Name | 2-(5-chloro-2-methoxyphenyl)-4-[(2,4-dibromophenyl)iminomethyl]-1,3-oxazol-5-ol |
| SMILES | COc1ccc(Cl)cc1-c1nc(/C=N/c2ccc(Br)cc2Br)c(O)o1 |
| InChI | InChI=1S/C17H11Br2ClN2O3/c1-24-15-5-3-10(20)7-11(15)16-22-14(17(23)25-16)8-21-13-4-2-9(18)6-12(13)19/h2-8,23H,1H3/b21-8+ |
| InChIKey | AVIXCAYAPCUBBC-ODCIPOBUSA-N |
| XLogP | 5.98 |
| TPSA | 67.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|