C18H12ClN3O3S — CID 5193579
4-(1,3-benzothiazol-2-yliminomethyl)-2-(5-chloro-2-methoxyphenyl)-1,3-oxazol-5-ol (PubChem CID 5193579) has the molecular formula C18H12ClN3O3S and a molecular weight of 385.83 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yliminomethyl)-2-(5-chloro-2-methoxyphenyl)-1,3-oxazol-5-ol.
| Compound Name | 4-(1,3-benzothiazol-2-yliminomethyl)-2-(5-chloro-2-methoxyphenyl)-1,3-oxazol-5-ol |
|---|---|
| PubChem CID | 5193579 |
| Molecular Formula | C18H12ClN3O3S |
| Molecular Weight | 385.83 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yliminomethyl)-2-(5-chloro-2-methoxyphenyl)-1,3-oxazol-5-ol |
| SMILES | COc1ccc(Cl)cc1-c1nc(C=Nc2nc3ccccc3s2)c(O)o1 |
| InChI | InChI=1S/C18H12ClN3O3S/c1-24-14-7-6-10(19)8-11(14)16-21-13(17(23)25-16)9-20-18-22-12-4-2-3-5-15(12)26-18/h2-9,23H,1H3 |
| InChIKey | FKFFYZRJMSHZLZ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 80.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.83 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|