C15H11NO2S — CID 163198854
3-(1,3-benzothiazol-2-yl)-4-methoxybenzaldehyde (PubChem CID 163198854) has the molecular formula C15H11NO2S and a molecular weight of 269.33 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-4-methoxybenzaldehyde.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-4-methoxybenzaldehyde |
|---|---|
| PubChem CID | 163198854 |
| Molecular Formula | C15H11NO2S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-4-methoxybenzaldehyde |
| SMILES | COc1ccc(C=O)cc1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C15H11NO2S/c1-18-13-7-6-10(9-17)8-11(13)15-16-12-4-2-3-5-14(12)19-15/h2-9H,1H3 |
| InChIKey | DCWPMYJIWFMMHM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|