C32H30N2O6S2 — CID 160986314
2-(3,4,5-trimethoxyphenyl)-1,3-benzothiazole (PubChem CID 160986314) has the molecular formula C32H30N2O6S2 and a molecular weight of 602.73 g/mol. Its IUPAC name is 2-(3,4,5-trimethoxyphenyl)-1,3-benzothiazole.
| Compound Name | 2-(3,4,5-trimethoxyphenyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 160986314 |
| Molecular Formula | C32H30N2O6S2 |
| Molecular Weight | 602.73 g/mol |
| Exact Mass | 602.15 |
| IUPAC Name | 2-(3,4,5-trimethoxyphenyl)-1,3-benzothiazole |
| SMILES | COc1cc(-c2nc3ccccc3s2)cc(OC)c1OC.COc1cc(-c2nc3ccccc3s2)cc(OC)c1OC |
| InChI | InChI=1S/2C16H15NO3S/c2*1-18-12-8-10(9-13(19-2)15(12)20-3)16-17-11-6-4-5-7-14(11)21-16/h2*4-9H,1-3H3 |
| InChIKey | TUAGQIDBIUTWEM-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 81.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.73 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |