C26H27NO3S — CID 126263509
2-[4-[2-(4-tert-butylphenoxy)ethoxy]-3-methoxyphenyl]-1,3-benzothiazole (PubChem CID 126263509) has the molecular formula C26H27NO3S and a molecular weight of 433.57 g/mol. Its IUPAC name is 2-[4-[2-(4-tert-butylphenoxy)ethoxy]-3-methoxyphenyl]-1,3-benzothiazole.
| Compound Name | 2-[4-[2-(4-tert-butylphenoxy)ethoxy]-3-methoxyphenyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 126263509 |
| Molecular Formula | C26H27NO3S |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | 2-[4-[2-(4-tert-butylphenoxy)ethoxy]-3-methoxyphenyl]-1,3-benzothiazole |
| SMILES | COc1cc(-c2nc3ccccc3s2)ccc1OCCOc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C26H27NO3S/c1-26(2,3)19-10-12-20(13-11-19)29-15-16-30-22-14-9-18(17-23(22)28-4)25-27-21-7-5-6-8-24(21)31-25/h5-14,17H,15-16H2,1-4H3 |
| InChIKey | ODKYHHRTNPWGSM-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|