C18H16NO4S- — CID 22307125
2-[4-(1,3-benzothiazol-2-yl)-2-methoxyphenoxy]butanoate (PubChem CID 22307125) has the molecular formula C18H16NO4S- and a molecular weight of 342.40 g/mol. Its IUPAC name is 2-[4-(1,3-benzothiazol-2-yl)-2-methoxyphenoxy]butanoate.
| Compound Name | 2-[4-(1,3-benzothiazol-2-yl)-2-methoxyphenoxy]butanoate |
|---|---|
| PubChem CID | 22307125 |
| Molecular Formula | C18H16NO4S- |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 2-[4-(1,3-benzothiazol-2-yl)-2-methoxyphenoxy]butanoate |
| SMILES | CCC(Oc1ccc(-c2nc3ccccc3s2)cc1OC)C(=O)[O-] |
| InChI | InChI=1S/C18H17NO4S/c1-3-13(18(20)21)23-14-9-8-11(10-15(14)22-2)17-19-12-6-4-5-7-16(12)24-17/h4-10,13H,3H2,1-2H3,(H,20,21)/p-1 |
| InChIKey | QTYVLJLSVFUFIL-UHFFFAOYSA-M |
| XLogP | 2.88 |
| TPSA | 71.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |