C21H14INO3S — CID 126257735
[4-(1,3-benzothiazol-2-yl)-2-methoxyphenyl] 2-iodobenzoate (PubChem CID 126257735) has the molecular formula C21H14INO3S and a molecular weight of 487.32 g/mol. Its IUPAC name is [4-(1,3-benzothiazol-2-yl)-2-methoxyphenyl] 2-iodobenzoate.
| Compound Name | [4-(1,3-benzothiazol-2-yl)-2-methoxyphenyl] 2-iodobenzoate |
|---|---|
| PubChem CID | 126257735 |
| Molecular Formula | C21H14INO3S |
| Molecular Weight | 487.32 g/mol |
| Exact Mass | 486.97 |
| IUPAC Name | [4-(1,3-benzothiazol-2-yl)-2-methoxyphenyl] 2-iodobenzoate |
| SMILES | COc1cc(-c2nc3ccccc3s2)ccc1OC(=O)c1ccccc1I |
| InChI | InChI=1S/C21H14INO3S/c1-25-18-12-13(20-23-16-8-4-5-9-19(16)27-20)10-11-17(18)26-21(24)14-6-2-3-7-15(14)22/h2-12H,1H3 |
| InChIKey | PPHWPBZFVYJBAH-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.32 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|