C21H16ClN3O3S — CID 88990043
N-[5-(1,3-benzothiazol-2-yl)-2-methoxyphenyl]-2-chloro-4-(hydroxyamino)benzamide (PubChem CID 88990043) has the molecular formula C21H16ClN3O3S and a molecular weight of 425.90 g/mol. Its IUPAC name is N-[5-(1,3-benzothiazol-2-yl)-2-methoxyphenyl]-2-chloro-4-(hydroxyamino)benzamide.
| Compound Name | N-[5-(1,3-benzothiazol-2-yl)-2-methoxyphenyl]-2-chloro-4-(hydroxyamino)benzamide |
|---|---|
| PubChem CID | 88990043 |
| Molecular Formula | C21H16ClN3O3S |
| Molecular Weight | 425.90 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | N-[5-(1,3-benzothiazol-2-yl)-2-methoxyphenyl]-2-chloro-4-(hydroxyamino)benzamide |
| SMILES | COc1ccc(-c2nc3ccccc3s2)cc1NC(=O)c1ccc(NO)cc1Cl |
| InChI | InChI=1S/C21H16ClN3O3S/c1-28-18-9-6-12(21-24-16-4-2-3-5-19(16)29-21)10-17(18)23-20(26)14-8-7-13(25-27)11-15(14)22/h2-11,25,27H,1H3,(H,23,26) |
| InChIKey | GRPCHTJFRCOMBD-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.90 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|