C22H17ClN2O3S — CID 1048170
N-[5-(1,3-benzothiazol-2-yl)-2-chlorophenyl]-3,4-dimethoxybenzamide (PubChem CID 1048170) has the molecular formula C22H17ClN2O3S and a molecular weight of 424.91 g/mol. Its IUPAC name is N-[5-(1,3-benzothiazol-2-yl)-2-chlorophenyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[5-(1,3-benzothiazol-2-yl)-2-chlorophenyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 1048170 |
| Molecular Formula | C22H17ClN2O3S |
| Molecular Weight | 424.91 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | N-[5-(1,3-benzothiazol-2-yl)-2-chlorophenyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2cc(-c3nc4ccccc4s3)ccc2Cl)cc1OC |
| InChI | InChI=1S/C22H17ClN2O3S/c1-27-18-10-8-13(12-19(18)28-2)21(26)24-17-11-14(7-9-15(17)23)22-25-16-5-3-4-6-20(16)29-22/h3-12H,1-2H3,(H,24,26) |
| InChIKey | PDLBVHGZQUZTQY-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.91 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |