C22H18N2O4S — CID 1363526
N-[4-(1,3-benzothiazol-2-yl)-3-hydroxyphenyl]-3,4-dimethoxybenzamide (PubChem CID 1363526) has the molecular formula C22H18N2O4S and a molecular weight of 406.46 g/mol. Its IUPAC name is N-[4-(1,3-benzothiazol-2-yl)-3-hydroxyphenyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[4-(1,3-benzothiazol-2-yl)-3-hydroxyphenyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 1363526 |
| Molecular Formula | C22H18N2O4S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | N-[4-(1,3-benzothiazol-2-yl)-3-hydroxyphenyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(-c3nc4ccccc4s3)c(O)c2)cc1OC |
| InChI | InChI=1S/C22H18N2O4S/c1-27-18-10-7-13(11-19(18)28-2)21(26)23-14-8-9-15(17(25)12-14)22-24-16-5-3-4-6-20(16)29-22/h3-12,25H,1-2H3,(H,23,26) |
| InChIKey | ZXHPYFLTYJPNJK-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |