C16H13N3O2S2 — CID 137075432
N-[[4-(1,3-benzothiazol-2-yl)-3-hydroxyphenyl]carbamothioyl]acetamide (PubChem CID 137075432) has the molecular formula C16H13N3O2S2 and a molecular weight of 343.43 g/mol. Its IUPAC name is N-[[4-(1,3-benzothiazol-2-yl)-3-hydroxyphenyl]carbamothioyl]acetamide.
| Compound Name | N-[[4-(1,3-benzothiazol-2-yl)-3-hydroxyphenyl]carbamothioyl]acetamide |
|---|---|
| PubChem CID | 137075432 |
| Molecular Formula | C16H13N3O2S2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | N-[[4-(1,3-benzothiazol-2-yl)-3-hydroxyphenyl]carbamothioyl]acetamide |
| SMILES | CC(=O)NC(=S)Nc1ccc(-c2nc3ccccc3s2)c(O)c1 |
| InChI | InChI=1S/C16H13N3O2S2/c1-9(20)17-16(22)18-10-6-7-11(13(21)8-10)15-19-12-4-2-3-5-14(12)23-15/h2-8,21H,1H3,(H2,17,18,20,22) |
| InChIKey | OOCXSCFAGVNDPK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|