C23H19N3O2S2 — CID 2282153
N-[[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]carbamothioyl]-3,4-dimethylbenzamide (PubChem CID 2282153) has the molecular formula C23H19N3O2S2 and a molecular weight of 433.56 g/mol. Its IUPAC name is N-[[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]carbamothioyl]-3,4-dimethylbenzamide.
| Compound Name | N-[[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]carbamothioyl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 2282153 |
| Molecular Formula | C23H19N3O2S2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | N-[[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]carbamothioyl]-3,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)NC(=S)Nc2ccc(O)c(-c3nc4ccccc4s3)c2)cc1C |
| InChI | InChI=1S/C23H19N3O2S2/c1-13-7-8-15(11-14(13)2)21(28)26-23(29)24-16-9-10-19(27)17(12-16)22-25-18-5-3-4-6-20(18)30-22/h3-12,27H,1-2H3,(H2,24,26,28,29) |
| InChIKey | IXAZPIIXUJGNHQ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|