C23H13Cl2N3O2S3 — CID 5038719
N-[[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]carbamothioyl]-3,6-dichloro-1-benzothiophene-2-carboxamide (PubChem CID 5038719) has the molecular formula C23H13Cl2N3O2S3 and a molecular weight of 530.48 g/mol. Its IUPAC name is N-[[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]carbamothioyl]-3,6-dichloro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]carbamothioyl]-3,6-dichloro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 5038719 |
| Molecular Formula | C23H13Cl2N3O2S3 |
| Molecular Weight | 530.48 g/mol |
| Exact Mass | 528.95 |
| IUPAC Name | N-[[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]carbamothioyl]-3,6-dichloro-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccc(O)c(-c2nc3ccccc3s2)c1)c1sc2cc(Cl)ccc2c1Cl |
| InChI | InChI=1S/C23H13Cl2N3O2S3/c24-11-5-7-13-18(9-11)32-20(19(13)25)21(30)28-23(31)26-12-6-8-16(29)14(10-12)22-27-15-3-1-2-4-17(15)33-22/h1-10,29H,(H2,26,28,30,31) |
| InChIKey | BLSRAZPKPGCNBH-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.48 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|