C16H10Cl2N2O2S2 — CID 4942217
3-chloro-N-[(5-chloro-2-hydroxyphenyl)carbamothioyl]-1-benzothiophene-2-carboxamide (PubChem CID 4942217) has the molecular formula C16H10Cl2N2O2S2 and a molecular weight of 397.31 g/mol. Its IUPAC name is 3-chloro-N-[(5-chloro-2-hydroxyphenyl)carbamothioyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[(5-chloro-2-hydroxyphenyl)carbamothioyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 4942217 |
| Molecular Formula | C16H10Cl2N2O2S2 |
| Molecular Weight | 397.31 g/mol |
| Exact Mass | 395.96 |
| IUPAC Name | 3-chloro-N-[(5-chloro-2-hydroxyphenyl)carbamothioyl]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1cc(Cl)ccc1O)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C16H10Cl2N2O2S2/c17-8-5-6-11(21)10(7-8)19-16(23)20-15(22)14-13(18)9-3-1-2-4-12(9)24-14/h1-7,21H,(H2,19,20,22,23) |
| InChIKey | AIZSHDQNNXAPCG-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.31 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|