C16H10ClFN2OS2 — CID 4927956
3-chloro-N-[(2-fluorophenyl)carbamothioyl]-1-benzothiophene-2-carboxamide (PubChem CID 4927956) has the molecular formula C16H10ClFN2OS2 and a molecular weight of 364.85 g/mol. Its IUPAC name is 3-chloro-N-[(2-fluorophenyl)carbamothioyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[(2-fluorophenyl)carbamothioyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 4927956 |
| Molecular Formula | C16H10ClFN2OS2 |
| Molecular Weight | 364.85 g/mol |
| Exact Mass | 363.99 |
| IUPAC Name | 3-chloro-N-[(2-fluorophenyl)carbamothioyl]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccccc1F)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C16H10ClFN2OS2/c17-13-9-5-1-4-8-12(9)23-14(13)15(21)20-16(22)19-11-7-3-2-6-10(11)18/h1-8H,(H2,19,20,21,22) |
| InChIKey | RFDNJJMOJRQQGN-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.85 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|