C16H9Cl3N2OS2 — CID 2265258
3-chloro-N-[(2,5-dichlorophenyl)carbamothioyl]-1-benzothiophene-2-carboxamide (PubChem CID 2265258) has the molecular formula C16H9Cl3N2OS2 and a molecular weight of 415.75 g/mol. Its IUPAC name is 3-chloro-N-[(2,5-dichlorophenyl)carbamothioyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[(2,5-dichlorophenyl)carbamothioyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 2265258 |
| Molecular Formula | C16H9Cl3N2OS2 |
| Molecular Weight | 415.75 g/mol |
| Exact Mass | 413.92 |
| IUPAC Name | 3-chloro-N-[(2,5-dichlorophenyl)carbamothioyl]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1cc(Cl)ccc1Cl)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C16H9Cl3N2OS2/c17-8-5-6-10(18)11(7-8)20-16(23)21-15(22)14-13(19)9-3-1-2-4-12(9)24-14/h1-7H,(H2,20,21,22,23) |
| InChIKey | ZAIQAPKCEQNWHJ-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.75 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|