C17H12Cl3N3OS2 — CID 11775140
1-(2-chloro-5-methylphenyl)-3-[(3,5-dichloro-1-benzothiophene-2-carbonyl)amino]thiourea (PubChem CID 11775140) has the molecular formula C17H12Cl3N3OS2 and a molecular weight of 444.80 g/mol. Its IUPAC name is 1-(2-chloro-5-methylphenyl)-3-[(3,5-dichloro-1-benzothiophene-2-carbonyl)amino]thiourea.
| Compound Name | 1-(2-chloro-5-methylphenyl)-3-[(3,5-dichloro-1-benzothiophene-2-carbonyl)amino]thiourea |
|---|---|
| PubChem CID | 11775140 |
| Molecular Formula | C17H12Cl3N3OS2 |
| Molecular Weight | 444.80 g/mol |
| Exact Mass | 442.95 |
| IUPAC Name | 1-(2-chloro-5-methylphenyl)-3-[(3,5-dichloro-1-benzothiophene-2-carbonyl)amino]thiourea |
| SMILES | Cc1ccc(Cl)c(NC(=S)NNC(=O)c2sc3ccc(Cl)cc3c2Cl)c1 |
| InChI | InChI=1S/C17H12Cl3N3OS2/c1-8-2-4-11(19)12(6-8)21-17(25)23-22-16(24)15-14(20)10-7-9(18)3-5-13(10)26-15/h2-7H,1H3,(H,22,24)(H2,21,23,25) |
| InChIKey | LQSKKPMAYYGTOR-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.80 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|