C17H12Cl2N2OS2 — CID 4937654
3-chloro-N-[(5-chloro-2-methylphenyl)carbamothioyl]-1-benzothiophene-2-carboxamide (PubChem CID 4937654) has the molecular formula C17H12Cl2N2OS2 and a molecular weight of 395.34 g/mol. Its IUPAC name is 3-chloro-N-[(5-chloro-2-methylphenyl)carbamothioyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[(5-chloro-2-methylphenyl)carbamothioyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 4937654 |
| Molecular Formula | C17H12Cl2N2OS2 |
| Molecular Weight | 395.34 g/mol |
| Exact Mass | 393.98 |
| IUPAC Name | 3-chloro-N-[(5-chloro-2-methylphenyl)carbamothioyl]-1-benzothiophene-2-carboxamide |
| SMILES | Cc1ccc(Cl)cc1NC(=S)NC(=O)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C17H12Cl2N2OS2/c1-9-6-7-10(18)8-12(9)20-17(23)21-16(22)15-14(19)11-4-2-3-5-13(11)24-15/h2-8H,1H3,(H2,20,21,22,23) |
| InChIKey | NCFLPZRSYAGEEW-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.34 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|