C20H18ClN3O3S2 — CID 17150441
3-chloro-N-[[2-(2-methoxyethylcarbamoyl)phenyl]carbamothioyl]-1-benzothiophene-2-carboxamide (PubChem CID 17150441) has the molecular formula C20H18ClN3O3S2 and a molecular weight of 447.97 g/mol. Its IUPAC name is 3-chloro-N-[[2-(2-methoxyethylcarbamoyl)phenyl]carbamothioyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[[2-(2-methoxyethylcarbamoyl)phenyl]carbamothioyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 17150441 |
| Molecular Formula | C20H18ClN3O3S2 |
| Molecular Weight | 447.97 g/mol |
| Exact Mass | 447.05 |
| IUPAC Name | 3-chloro-N-[[2-(2-methoxyethylcarbamoyl)phenyl]carbamothioyl]-1-benzothiophene-2-carboxamide |
| SMILES | COCCNC(=O)c1ccccc1NC(=S)NC(=O)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C20H18ClN3O3S2/c1-27-11-10-22-18(25)12-6-2-4-8-14(12)23-20(28)24-19(26)17-16(21)13-7-3-5-9-15(13)29-17/h2-9H,10-11H2,1H3,(H,22,25)(H2,23,24,26,28) |
| InChIKey | UGPOYPRUBGKBOK-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.97 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|