C23H22ClN3O2S2 — CID 4937991
N-[[2-(azepane-1-carbonyl)phenyl]carbamothioyl]-3-chloro-1-benzothiophene-2-carboxamide (PubChem CID 4937991) has the molecular formula C23H22ClN3O2S2 and a molecular weight of 472.04 g/mol. Its IUPAC name is N-[[2-(azepane-1-carbonyl)phenyl]carbamothioyl]-3-chloro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[[2-(azepane-1-carbonyl)phenyl]carbamothioyl]-3-chloro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 4937991 |
| Molecular Formula | C23H22ClN3O2S2 |
| Molecular Weight | 472.04 g/mol |
| Exact Mass | 471.08 |
| IUPAC Name | N-[[2-(azepane-1-carbonyl)phenyl]carbamothioyl]-3-chloro-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccccc1C(=O)N1CCCCCC1)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C23H22ClN3O2S2/c24-19-16-10-4-6-12-18(16)31-20(19)21(28)26-23(30)25-17-11-5-3-9-15(17)22(29)27-13-7-1-2-8-14-27/h3-6,9-12H,1-2,7-8,13-14H2,(H2,25,26,28,30) |
| InChIKey | WESLUMITBDMRSF-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.04 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|