C22H22ClN3OS2 — CID 3316135
3-chloro-N-[[4-(piperidin-1-ylmethyl)phenyl]carbamothioyl]-1-benzothiophene-2-carboxamide (PubChem CID 3316135) has the molecular formula C22H22ClN3OS2 and a molecular weight of 444.03 g/mol. Its IUPAC name is 3-chloro-N-[[4-(piperidin-1-ylmethyl)phenyl]carbamothioyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[[4-(piperidin-1-ylmethyl)phenyl]carbamothioyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 3316135 |
| Molecular Formula | C22H22ClN3OS2 |
| Molecular Weight | 444.03 g/mol |
| Exact Mass | 443.09 |
| IUPAC Name | 3-chloro-N-[[4-(piperidin-1-ylmethyl)phenyl]carbamothioyl]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccc(CN2CCCCC2)cc1)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C22H22ClN3OS2/c23-19-17-6-2-3-7-18(17)29-20(19)21(27)25-22(28)24-16-10-8-15(9-11-16)14-26-12-4-1-5-13-26/h2-3,6-11H,1,4-5,12-14H2,(H2,24,25,27,28) |
| InChIKey | YOMAQEIFTGCJNW-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.03 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|