C21H20ClN3O2S2 — CID 17197083
3-chloro-N-[[4-(diethylcarbamoyl)phenyl]carbamothioyl]-1-benzothiophene-2-carboxamide (PubChem CID 17197083) has the molecular formula C21H20ClN3O2S2 and a molecular weight of 446.00 g/mol. Its IUPAC name is 3-chloro-N-[[4-(diethylcarbamoyl)phenyl]carbamothioyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[[4-(diethylcarbamoyl)phenyl]carbamothioyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 17197083 |
| Molecular Formula | C21H20ClN3O2S2 |
| Molecular Weight | 446.00 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | 3-chloro-N-[[4-(diethylcarbamoyl)phenyl]carbamothioyl]-1-benzothiophene-2-carboxamide |
| SMILES | CCN(CC)C(=O)c1ccc(NC(=S)NC(=O)c2sc3ccccc3c2Cl)cc1 |
| InChI | InChI=1S/C21H20ClN3O2S2/c1-3-25(4-2)20(27)13-9-11-14(12-10-13)23-21(28)24-19(26)18-17(22)15-7-5-6-8-16(15)29-18/h5-12H,3-4H2,1-2H3,(H2,23,24,26,28) |
| InChIKey | HGZGVMWGVQJNHF-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.00 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|